
CAS 887592-67-8
:3-(4-Methoxy-1-naphthalenyl)pyrrolidine
Description:
3-(4-Methoxy-1-naphthalenyl)pyrrolidine, with the CAS number 887592-67-8, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a methoxy-substituted naphthalene moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the methoxy group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. Additionally, the naphthalene ring can provide significant π-π stacking interactions, which may be relevant in drug design and molecular recognition processes. The compound may also exhibit various functional properties, including potential pharmacological effects, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its reactivity and interactions in various chemical environments. Overall, 3-(4-Methoxy-1-naphthalenyl)pyrrolidine represents a versatile structure with implications in both synthetic and applied chemistry.
Formula:C15H17NO
InChI:InChI=1S/C15H17NO/c1-17-15-7-6-12(11-8-9-16-10-11)13-4-2-3-5-14(13)15/h2-7,11,16H,8-10H2,1H3
InChI key:InChIKey=ZMXVSILENFCFJB-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C(=CC1)C3CCNC3)C=CC=C2
Synonyms:- 3-(4-Methoxy-1-naphthalenyl)pyrrolidine
- Pyrrolidine, 3-(4-methoxy-1-naphthalenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.