CAS 887592-86-1
:4-(Hydrazinylmethyl)-N,N-dimethyl-1-naphthalenamine
Description:
4-(Hydrazinylmethyl)-N,N-dimethyl-1-naphthalenamine, with the CAS number 887592-86-1, is an organic compound characterized by its naphthalene structure, which is a polycyclic aromatic hydrocarbon. This compound features a hydrazine functional group, which is known for its reactivity and ability to form various derivatives. The presence of dimethylamine groups indicates that it has two methyl groups attached to the nitrogen atom, enhancing its nucleophilicity. The hydrazinylmethyl substituent suggests potential applications in medicinal chemistry, particularly in the synthesis of hydrazone derivatives, which are often explored for their biological activities. The compound may exhibit properties such as moderate solubility in organic solvents and potential reactivity with electrophiles due to the presence of the hydrazine moiety. Additionally, its structural features may allow for interactions with biological targets, making it of interest in drug development and research. However, specific safety and handling guidelines should be followed due to the potential hazards associated with hydrazine derivatives.
Formula:C13H17N3
InChI:InChI=1S/C13H17N3/c1-16(2)13-8-7-10(9-15-14)11-5-3-4-6-12(11)13/h3-8,15H,9,14H2,1-2H3
InChI key:InChIKey=FYWQXZKODACSPD-UHFFFAOYSA-N
SMILES:N(C)(C)C=1C2=C(C(CNN)=CC1)C=CC=C2
Synonyms:- 4-(Hydrazinylmethyl)-N,N-dimethyl-1-naphthalenamine
- 1-Naphthalenamine, 4-(hydrazinylmethyl)-N,N-dimethyl-
- 1-Naphthalenamine, 4-(hydrazinomethyl)-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
