
CAS 887593-27-3
:3-(Hydrazinylmethyl)-1-methyl-1H-indole
Description:
3-(Hydrazinylmethyl)-1-methyl-1H-indole, identified by its CAS number 887593-27-3, is a chemical compound that features a hydrazine functional group attached to an indole structure. This compound typically exhibits characteristics associated with both indole derivatives and hydrazines, including potential biological activity. Indoles are known for their aromatic properties and can participate in various chemical reactions, while hydrazines are recognized for their reactivity and ability to form bonds with carbonyl compounds. The presence of the hydrazinylmethyl group may enhance the compound's reactivity, making it of interest in medicinal chemistry and drug development. Additionally, compounds of this nature may exhibit properties such as antioxidant activity or potential use in the synthesis of more complex molecules. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety and handling precautions should be observed due to the potential toxicity associated with hydrazine derivatives.
Formula:C10H13N3
InChI:InChI=1S/C10H13N3/c1-13-7-8(6-12-11)9-4-2-3-5-10(9)13/h2-5,7,12H,6,11H2,1H3
InChI key:InChIKey=HWUJHPMGZYZECS-UHFFFAOYSA-N
SMILES:C(NN)C=1C=2C(N(C)C1)=CC=CC2
Synonyms:- 3-(Hydrazinylmethyl)-1-methyl-1H-indole
- 1H-Indole, 3-(hydrazinylmethyl)-1-methyl-
- 1H-Indole, 3-(hydrazinomethyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.