CAS 887593-51-3
:2,3-dihydro-1H-inden-5-ylhydrazine
Description:
2,3-Dihydro-1H-inden-5-ylhydrazine is an organic compound characterized by its unique bicyclic structure, which includes a hydrazine functional group. This compound features a five-membered indene ring fused with a six-membered hydrazine moiety, contributing to its distinct chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydrazine group imparts reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophilic substitution and condensation. Additionally, the compound may exhibit biological activity, which has garnered interest in medicinal chemistry. Its solubility characteristics can vary, often being soluble in polar organic solvents. Safety considerations are important, as hydrazine derivatives can be toxic and potentially carcinogenic. Therefore, handling this compound requires appropriate safety measures. Overall, 2,3-dihydro-1H-inden-5-ylhydrazine is a compound of interest in both synthetic and medicinal chemistry due to its structural features and reactivity.
Formula:C9H12N2
InChI:InChI=1/C9H12N2/c10-11-9-5-4-7-2-1-3-8(7)6-9/h4-6,11H,1-3,10H2
SMILES:C1Cc2ccc(cc2C1)NN
Synonyms:- hydrazine, (2,3-dihydro-1H-inden-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,3-Dihydro-1H-inden-5-ylhydrazine
CAS:2,3-Dihydro-1H-inden-5-ylhydrazine
Molecular weight:148.20g/mol

