
CAS 887593-60-4
:3-(Hydrazinylmethyl)quinoline
Description:
3-(Hydrazinylmethyl)quinoline is an organic compound characterized by the presence of a quinoline moiety, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. This compound features a hydrazinylmethyl group, indicating the presence of a hydrazine functional group (-NH-NH2) attached to a methylene (-CH2-) bridge linked to the quinoline structure. The presence of both the hydrazine and quinoline functionalities suggests potential reactivity, particularly in forming hydrazones or engaging in nucleophilic reactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly for its potential as an antitumor or antimicrobial agent. Its physical properties, such as solubility and melting point, would depend on the specific molecular interactions and the presence of functional groups. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, which could be relevant in the development of materials or sensors. Safety and handling precautions should be observed due to the potential toxicity associated with hydrazine derivatives.
Formula:C10H11N3
InChI:InChI=1S/C10H11N3/c11-13-7-8-5-9-3-1-2-4-10(9)12-6-8/h1-6,13H,7,11H2
InChI key:InChIKey=BGQLQINLPFFFKE-UHFFFAOYSA-N
SMILES:C(NN)C1=CC2=C(N=C1)C=CC=C2
Synonyms:- 3-(Hydrazinylmethyl)quinoline
- Quinoline, 3-(hydrazinylmethyl)-
- Quinoline, 3-(hydrazinomethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
