CymitQuimica logo

CAS 887594-18-5

:

[(4-Phenoxyphenyl)methyl]hydrazine

Description:
[(4-Phenoxyphenyl)methyl]hydrazine is an organic compound characterized by its hydrazine functional group, which is linked to a phenyl ring substituted with a phenoxy group. This compound typically exhibits properties associated with both hydrazines and aromatic compounds, including potential reactivity due to the presence of the hydrazine moiety, which can participate in various chemical reactions such as oxidation and condensation. The phenoxy group contributes to the compound's stability and may influence its solubility in organic solvents. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of multiple aromatic rings can also impart unique electronic properties, potentially affecting the compound's interaction with biological targets. Safety and handling precautions are essential, as hydrazines are known to be toxic and potentially carcinogenic. Overall, [(4-Phenoxyphenyl)methyl]hydrazine represents a class of compounds that may have diverse applications in research and industry, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C13H14N2O
InChI:InChI=1S/C13H14N2O/c14-15-10-11-6-8-13(9-7-11)16-12-4-2-1-3-5-12/h1-9,15H,10,14H2
InChI key:InChIKey=DTXHVZRQKYCONL-UHFFFAOYSA-N
SMILES:O(C1=CC=C(CNN)C=C1)C2=CC=CC=C2
Synonyms:
  • [(4-Phenoxyphenyl)methyl]hydrazine
  • Hydrazine, [(4-phenoxyphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.