CAS 887595-18-8

4-(Hydrazinylmethyl)-3-methoxyphenol

Description:

4-(Hydrazinylmethyl)-3-methoxyphenol, identified by its CAS number 887595-18-8, is an organic compound characterized by the presence of a hydrazine functional group and a methoxyphenol structure. This compound typically exhibits properties associated with both phenolic and hydrazine derivatives, which may include moderate solubility in polar solvents due to the presence of the hydrazine and methoxy groups. The phenolic hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interaction with other chemical species. Additionally, the compound may exhibit antioxidant properties due to the phenolic structure, which can scavenge free radicals. Its hydrazine component suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as hydrazines are often involved in the synthesis of various bioactive compounds. However, handling precautions are necessary due to the potential toxicity associated with hydrazine derivatives. Overall, 4-(Hydrazinylmethyl)-3-methoxyphenol is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₈H₁₂N₂O₂

InChI: InChI=1S/C8H12N2O2/c1-12-8-4-7(11)3-2-6(8)5-10-9/h2-4,10-11H,5,9H2,1H3

InChI key: InChIKey=DPMHXOBGMGURAE-UHFFFAOYSA-N

SMILES: C(NN)C1=C(OC)C=C(O)C=C1

Synonyms:

• Phenol, 4-(hydrazinylmethyl)-3-methoxy-
• 4-(Hydrazinylmethyl)-3-methoxyphenol
• Phenol, 4-(hydrazinomethyl)-3-methoxy-