CAS 887595-31-5
:1-[3-Nitro-4-(1-pyrrolidinyl)phenyl]ethanone
Description:
1-[3-Nitro-4-(1-pyrrolidinyl)phenyl]ethanone, with the CAS number 887595-31-5, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with a nitro group and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the nitro group suggests that it may participate in electrophilic reactions, while the pyrrolidine ring can influence its solubility and interaction with biological targets. The ethanone functional group indicates that it is a ketone, which can participate in various chemical reactions, including nucleophilic additions. This compound may be of interest in medicinal chemistry due to its structural features that could lead to specific pharmacological effects. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in research related to drug development or as a chemical intermediate in various applications.
Formula:C12H14N2O3
InChI:InChI=1S/C12H14N2O3/c1-9(15)10-4-5-11(12(8-10)14(16)17)13-6-2-3-7-13/h4-5,8H,2-3,6-7H2,1H3
InChI key:InChIKey=VWRRVRRXUGSDIR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC(C(C)=O)=C1)N2CCCC2
Synonyms:- 1-(3-Nitro-4-Pyrrolidin-1-Yl-Phenyl)-Ethanone
- 1-[3-Nitro-4-(1-pyrrolidinyl)phenyl]ethanone
- Ethanone, 1-[3-nitro-4-(1-pyrrolidinyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
