CymitQuimica logo

CAS 887595-34-8

:

Ethanone, 1-[3-amino-4-(1-methyl-4(1H)-pyrazinyl)phenyl]-

Description:
Ethanone, 1-[3-amino-4-(1-methyl-4(1H)-pyrazinyl)phenyl]- is a chemical compound characterized by its complex structure, which includes an ethanone functional group and an amino group attached to a phenyl ring. The presence of a 1-methyl-4(1H)-pyrazinyl moiety indicates that it has a heterocyclic component, contributing to its potential biological activity. This compound may exhibit properties typical of both aromatic amines and ketones, such as reactivity in electrophilic substitution reactions and potential hydrogen bonding capabilities due to the amino group. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often demonstrate various biological activities. The CAS number 887595-34-8 uniquely identifies this substance in chemical databases, facilitating research and regulatory processes. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances.
Formula:C13H15N3O
InChI:InChI=1S/C13H15N3O/c1-10(17)11-3-4-13(12(14)9-11)16-7-5-15(2)6-8-16/h3-9H,14H2,1-2H3
InChI key:InChIKey=URHNUOKSSUHOOR-UHFFFAOYSA-N
SMILES:NC1=C(C=CC(C(C)=O)=C1)N2C=CN(C)C=C2
Synonyms:
  • 1-[3-Amino-4-(4-methylpyrazin-1-yl)phenyl]ethanone
  • 1-(3-Amino-4-(4-methylpyrazin-1(4H)-yl)phenyl)ethanone
  • Ethanone, 1-[3-amino-4-(1-methyl-4(1H)-pyrazinyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.