
CAS 887595-40-6
:1,1-Dimethylethyl 4-(4-acetyl-2-aminophenyl)-1(4H)-pyrazinecarboxylate
Description:
1,1-Dimethylethyl 4-(4-acetyl-2-aminophenyl)-1(4H)-pyrazinecarboxylate, with the CAS number 887595-40-6, is a chemical compound characterized by its complex structure, which includes a pyrazine ring and an acetyl-aminophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity due to the presence of the amino and carbonyl functional groups. It may be soluble in organic solvents, and its stability can be influenced by environmental factors such as temperature and pH. The presence of the dimethyl group suggests steric hindrance, which could affect its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies would be necessary to fully understand its pharmacological properties, toxicity, and potential applications in various fields.
Formula:C17H21N3O3
InChI:InChI=1S/C17H21N3O3/c1-12(21)13-5-6-15(14(18)11-13)19-7-9-20(10-8-19)16(22)23-17(2,3)4/h5-11H,18H2,1-4H3
InChI key:InChIKey=XHFHKCOWNUVMJB-UHFFFAOYSA-N
SMILES:NC1=C(C=CC(C(C)=O)=C1)N2C=CN(C(OC(C)(C)C)=O)C=C2
Synonyms:- 1(4H)-Pyrazinecarboxylic acid, 4-(4-acetyl-2-aminophenyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-(4-acetyl-2-aminophenyl)-1(4H)-pyrazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 4-(4-acetyl-2-aminophenyl)pyrazine-1(4H)-carboxylate
CAS:Formula:C17H21N3O3Molecular weight:315.3669
