CymitQuimica logo

CAS 887595-76-8

:

[(2-Bromo-5-methoxyphenyl)methyl]hydrazine

Description:
[(2-Bromo-5-methoxyphenyl)methyl]hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a substituted phenyl ring. The structure features a bromine atom and a methoxy group on the aromatic ring, which can influence its reactivity and solubility. The bromine substituent typically enhances electrophilic reactivity, while the methoxy group can provide electron-donating effects, affecting the compound's overall electronic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its hydrazine moiety is known for its potential in forming hydrazones and other derivatives, which can be useful in various synthetic applications. Additionally, the presence of halogens and methoxy groups can impact the compound's physical properties, such as melting point, boiling point, and solubility in different solvents. Safety considerations are important when handling this compound, as hydrazines are generally regarded as hazardous materials.
Formula:C8H11BrN2O
InChI:InChI=1S/C8H11BrN2O/c1-12-7-2-3-8(9)6(4-7)5-11-10/h2-4,11H,5,10H2,1H3
InChI key:InChIKey=RRWGXZQCDBRCRP-UHFFFAOYSA-N
SMILES:C(NN)C1=CC(OC)=CC=C1Br
Synonyms:
  • Hydrazine, [(2-bromo-5-methoxyphenyl)methyl]-
  • [(2-Bromo-5-methoxyphenyl)methyl]hydrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.