CAS 887595-82-6
:[2-(trifluoromethoxy)benzyl]hydrazine
Description:
[2-(Trifluoromethoxy)benzyl]hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a benzyl moiety that features a trifluoromethoxy substituent. This compound typically exhibits properties associated with both hydrazines and aromatic compounds, including potential reactivity due to the hydrazine group, which can participate in various chemical reactions such as condensation and oxidation. The trifluoromethoxy group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The presence of fluorine atoms often imparts unique electronic properties, potentially affecting the compound's stability and reactivity. Additionally, [2-(trifluoromethoxy)benzyl]hydrazine may exhibit specific solubility characteristics in organic solvents, and its molecular structure can lead to interesting interactions in biological systems. As with many hydrazine derivatives, safety precautions are necessary due to potential toxicity and reactivity. Overall, this compound's unique functional groups suggest a range of applications in research and development, particularly in pharmaceuticals and agrochemicals.
Formula:C8H9F3N2O
InChI:InChI=1/C8H9F3N2O/c9-8(10,11)14-7-4-2-1-3-6(7)5-13-12/h1-4,13H,5,12H2
SMILES:c1ccc(c(c1)CNN)OC(F)(F)F
Synonyms:- 1-{[2-(Trifluoromethoxy)Phenyl]Methyl}Hydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.