CymitQuimica logo

CAS 887595-84-8

:

[3-(trifluoromethoxy)benzyl]hydrazine

Description:
[3-(Trifluoromethoxy)benzyl]hydrazine is an organic compound characterized by its hydrazine functional group attached to a benzyl moiety that features a trifluoromethoxy substituent. This compound typically exhibits properties associated with both hydrazines and aromatic compounds, including potential reactivity due to the presence of the hydrazine group, which can participate in various chemical reactions such as oxidation and condensation. The trifluoromethoxy group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The presence of fluorine atoms can also impart unique electronic properties, potentially affecting the compound's stability and reactivity. In terms of physical properties, [3-(trifluoromethoxy)benzyl]hydrazine is likely to be a solid or liquid at room temperature, with solubility in organic solvents. Safety considerations are important, as hydrazines are known to be toxic and potentially carcinogenic, necessitating careful handling and storage. Overall, this compound's unique structure and functional groups make it a subject of interest in various chemical research fields.
Formula:C8H9F3N2O
InChI:InChI=1/C8H9F3N2O/c9-8(10,11)14-7-3-1-2-6(4-7)5-13-12/h1-4,13H,5,12H2
SMILES:c1cc(cc(c1)OC(F)(F)F)CNN
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.