CAS 887595-86-0

[[4-Chloro-3-(trifluoromethyl)phenyl]methyl]hydrazine

Description:

[[4-Chloro-3-(trifluoromethyl)phenyl]methyl]hydrazine, with the CAS number 887595-86-0, is a chemical compound characterized by its hydrazine functional group, which is known for its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of a chloro group and a trifluoromethyl group on the phenyl ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions, although it can be sensitive to moisture and air. Its reactivity can be attributed to the hydrazine moiety, which can participate in various chemical reactions, including oxidation and coupling reactions. Additionally, the presence of halogen substituents can affect its interaction with biological targets, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as hydrazines are generally considered hazardous due to their toxicity and potential carcinogenicity.

Formula: C₈H₈ClF₃N₂

InChI: InChI=1S/C8H8ClF3N2/c9-7-2-1-5(4-14-13)3-6(7)8(10,11)12/h1-3,14H,4,13H2

InChI key: InChIKey=QYZCPOGLBTUVLP-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(CNN)=CC=C1Cl

Synonyms:

• (4-Chloro-3-Trifluoromethyl-Benzyl)-Hydrazine
• [[4-Chloro-3-(trifluoromethyl)phenyl]methyl]hydrazine
• Hydrazine, [[4-chloro-3-(trifluoromethyl)phenyl]methyl]-

(4-Chloro-3-(trifluoromethyl)benzyl)hydrazine

CAS: 887595-86-0

Formula: C₈H₈ClF₃N₂

Molecular weight: 224.6107

Ref: IN-DA004B9L