CymitQuimica logo

CAS 887595-87-1

:

Methyl 1-(2-aminophenyl)-3-azetidinecarboxylate

Description:
Methyl 1-(2-aminophenyl)-3-azetidinecarboxylate, identified by its CAS number 887595-87-1, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the 2-aminophenyl group indicates that it has an amino substituent on a phenyl ring, which can participate in hydrogen bonding and influence the compound's biological activity. Methyl 1-(2-aminophenyl)-3-azetidinecarboxylate may exhibit properties such as moderate polarity, making it suitable for various applications in medicinal chemistry and drug development. Its structural characteristics suggest potential interactions with biological targets, which could be explored for therapeutic purposes. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise values. Overall, this compound represents a unique scaffold for further chemical exploration and potential pharmacological applications.
Formula:C11H14N2O2
InChI:InChI=1S/C11H14N2O2/c1-15-11(14)8-6-13(7-8)10-5-3-2-4-9(10)12/h2-5,8H,6-7,12H2,1H3
InChI key:InChIKey=RDSNRPRBBXFCRU-UHFFFAOYSA-N
SMILES:NC1=C(C=CC=C1)N2CC(C(OC)=O)C2
Synonyms:
  • 3-Azetidinecarboxylic acid, 1-(2-aminophenyl)-, methyl ester
  • Methyl 1-(2-aminophenyl)-3-azetidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.