CAS 887596-15-8

2-Chloro-4-(hydrazinylmethyl)phenol

Description:

2-Chloro-4-(hydrazinylmethyl)phenol, with the CAS number 887596-15-8, is an organic compound characterized by the presence of a chloro group and a hydrazinylmethyl substituent on a phenolic ring. This compound typically exhibits properties associated with both phenols and hydrazines, including potential reactivity due to the hydrazine functional group, which can participate in various chemical reactions such as condensation and oxidation. The chloro substituent may influence its solubility and reactivity, making it a candidate for various applications in organic synthesis and medicinal chemistry. The presence of the hydrazinyl group suggests potential biological activity, as hydrazines are often explored for their pharmacological properties. Additionally, the compound may exhibit specific physical properties such as melting and boiling points, which are influenced by its molecular structure and intermolecular interactions. Safety and handling precautions are essential, as compounds containing halogens and hydrazines can pose health risks. Overall, 2-Chloro-4-(hydrazinylmethyl)phenol is a compound of interest in both research and industrial contexts.

Formula: C₇H₉ClN₂O

InChI: InChI=1S/C7H9ClN2O/c8-6-3-5(4-10-9)1-2-7(6)11/h1-3,10-11H,4,9H2

InChI key: InChIKey=ODDMZZRMVXLVRD-UHFFFAOYSA-N

SMILES: C(NN)C1=CC(Cl)=C(O)C=C1

Synonyms:

• 2-Chloro-4-(hydrazinylmethyl)phenol
• Phenol, 2-chloro-4-(hydrazinylmethyl)-
• Phenol, 2-chloro-4-(hydrazinomethyl)-