CymitQuimica logo

CAS 887596-59-0

:

N-[4-(Hydrazinylmethyl)phenyl]acetamide

Description:
N-[4-(Hydrazinylmethyl)phenyl]acetamide, identified by its CAS number 887596-59-0, is a chemical compound characterized by the presence of a hydrazine functional group attached to a phenyl ring, which is further substituted with an acetamide group. This compound typically exhibits properties associated with both hydrazine and amide functionalities, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the amide group. It may also display biological activity, making it of interest in medicinal chemistry and drug development. The structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are common in organic synthesis. Additionally, its hydrazine component may impart specific properties, such as potential antioxidant activity or interactions with biological targets. As with many hydrazine derivatives, safety precautions should be observed due to the potential toxicity and reactivity of hydrazines.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c1-7(13)12-9-4-2-8(3-5-9)6-11-10/h2-5,11H,6,10H2,1H3,(H,12,13)
InChI key:InChIKey=SYIJVKDVNSLCFG-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC=C(CNN)C=C1
Synonyms:
  • N-[4-(Hydrazinylmethyl)phenyl]acetamide
  • Acetamide, N-[4-(hydrazinylmethyl)phenyl]-
  • Acetamide, N-[4-(hydrazinomethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.