CAS 887596-65-8

[4-(difluoromethoxy)phenyl]methylhydrazine hydrochloride

Description:

[4-(Difluoromethoxy)phenyl]methylhydrazine hydrochloride is a chemical compound characterized by its hydrazine functional group, which is known for its reactivity and potential applications in medicinal chemistry. The presence of the difluoromethoxy group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for formulation in pharmaceutical applications. The compound's structure suggests potential use in the development of therapeutic agents, particularly in the context of cancer research or as a building block in organic synthesis. Its molecular interactions, stability, and reactivity are influenced by the presence of the difluoromethoxy substituent, which can affect its electronic properties. Safety and handling precautions are essential due to the inherent risks associated with hydrazine derivatives, which can be toxic and potentially carcinogenic. As with any chemical, proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity in research and industrial applications.

Formula: C₈H₁₁ClF₂N₂O

InChI: InChI=1/C8H10F2N2O.ClH/c9-8(10)13-7-3-1-6(2-4-7)5-12-11;/h1-4,8,12H,5,11H2;1H

SMILES: c1cc(ccc1CNN)OC(F)F.Cl

4-(Difluoromethoxy)benzylhydrazine hydrochloride

CAS: 887596-65-8

4-(Difluoromethoxy)benzylhydrazine hydrochloride

Purity: ≥95%

Molecular weight: 224.64g/mol

Ref: 54-PC9519