CAS 887596-68-1

[(3-Bromo-4-fluorophenyl)methyl]hydrazine

Description:

[(3-Bromo-4-fluorophenyl)methyl]hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a phenyl ring that is further substituted with bromine and fluorine atoms. This compound typically exhibits properties associated with both hydrazines and aromatic halides, including potential reactivity due to the presence of the hydrazine moiety, which can participate in various chemical reactions such as nucleophilic substitutions and condensation reactions. The bromine and fluorine substituents can influence the compound's electronic properties, potentially enhancing its reactivity or altering its solubility in different solvents. Additionally, the presence of halogens may impart unique biological activities, making such compounds of interest in medicinal chemistry and material science. Safety considerations are important when handling this compound, as hydrazines are known to be toxic and potentially carcinogenic. Overall, [(3-Bromo-4-fluorophenyl)methyl]hydrazine represents a versatile structure with applications in various chemical research fields.

Formula: C₇H₈BrFN₂

InChI: InChI=1S/C7H8BrFN2/c8-6-3-5(4-11-10)1-2-7(6)9/h1-3,11H,4,10H2

InChI key: InChIKey=ZPPUZUUYQYNBHT-UHFFFAOYSA-N

SMILES: C(NN)C1=CC(Br)=C(F)C=C1

Synonyms:

• 3-Bromo-4-Fluoro-Benzyl-Hydrazine
• [(3-Bromo-4-fluorophenyl)methyl]hydrazine
• Hydrazine, [(3-bromo-4-fluorophenyl)methyl]-

[(3-bromo-4-fluorophenyl)methyl]hydrazine

CAS: 887596-68-1

Formula: C₇H₈BrFN₂

Molecular weight: 219.0542

Ref: IN-DA004B9G