
CAS 887596-90-9
:1-Phenylcyclohexanecarboxylic acid hydrazide
Description:
1-Phenylcyclohexanecarboxylic acid hydrazide is an organic compound characterized by the presence of a hydrazide functional group attached to a phenyl-substituted cyclohexanecarboxylic acid. This compound typically exhibits properties associated with both hydrazides and carboxylic acids, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the carboxylic acid moiety. It may appear as a solid at room temperature and is likely to be soluble in polar organic solvents. The compound can be utilized in various chemical syntheses and may exhibit biological activity, making it of interest in pharmaceutical research. Its structure allows for potential interactions with biological targets, which could lead to applications in medicinal chemistry. As with many hydrazides, it may also be sensitive to oxidation and could require careful handling and storage conditions to maintain its stability.
Formula:C13H18N2O
InChI:InChI=1S/C13H18N2O/c14-15-12(16)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10,14H2,(H,15,16)
InChI key:InChIKey=XABBLCCSPHWVIQ-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1(CCCCC1)C2=CC=CC=C2
Synonyms:- 1-Phenylcyclohexanecarboxylic acid hydrazide
- 1-Phenylcyclohexane-1-carbohydrazide
- Cyclohexanecarboxylic acid, 1-phenyl-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.