CAS 887602-89-3

Methyl indolizine-7-carboxylate

Description:

Methyl indolizine-7-carboxylate is a chemical compound characterized by its indolizine core structure, which is a bicyclic compound featuring a five-membered nitrogen-containing ring fused to a six-membered carbon ring. This compound typically exhibits a carboxylate functional group, which contributes to its reactivity and solubility properties. Methyl indolizine-7-carboxylate is often used in organic synthesis and medicinal chemistry due to its potential biological activity and ability to serve as a building block for more complex molecules. The presence of the methyl ester group enhances its lipophilicity, making it more soluble in organic solvents. Additionally, the indolizine moiety is known for its involvement in various chemical reactions, including cycloadditions and substitutions, which can lead to the formation of diverse derivatives. Overall, this compound's unique structure and functional groups make it a valuable intermediate in the development of pharmaceuticals and agrochemicals.

Formula: C₁₀H₉NO₂

InChI: InChI=1/C10H9NO2/c1-13-10(12)8-4-6-11-5-2-3-9(11)7-8/h2-7H,1H3

SMILES: COC(=O)c1ccn2cccc2c1

Synonyms:

• 7-Indolizinecarboxylic Acid, Methyl Ester
• methyl indolizine-7-carboxylate

Methyl indolizine-7-carboxylate

CAS: 887602-89-3

Formula: C₁₀H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.1840

Ref: IN-DA004B9E

Methyl indolizine-7-carboxylate

CAS: 887602-89-3

Methyl indolizine-7-carboxylate

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.18g/mol

Ref: 54-OR301176

Methyl indolizine-7-carboxylate

CAS: 887602-89-3

Formula: C₁₀H₉NO₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 175.187

Ref: 10-F077406