CymitQuimica logo

CAS 887623-93-0

:

1-(5-Chloro-1,2,4-thiadiazol-3-yl)-4-(phenylmethyl)piperazine

Description:
1-(5-Chloro-1,2,4-thiadiazol-3-yl)-4-(phenylmethyl)piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with a phenylmethyl group and a 5-chloro-1,2,4-thiadiazole moiety. This compound typically exhibits properties associated with both piperazine derivatives and thiadiazole compounds, which may include biological activity such as antimicrobial or antifungal effects. The presence of the chlorine atom in the thiadiazole ring can influence its reactivity and solubility, while the piperazine structure contributes to its potential as a pharmacophore in medicinal chemistry. The compound's molecular weight, solubility in various solvents, and stability under different conditions are important characteristics that can affect its application in research and industry. Additionally, its CAS number, 887623-93-0, serves as a unique identifier for regulatory and safety information. Overall, this compound's specific characteristics make it a subject of interest in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H15ClN4S
InChI:InChI=1S/C13H15ClN4S/c14-12-15-13(16-19-12)18-8-6-17(7-9-18)10-11-4-2-1-3-5-11/h1-5H,6-10H2
InChI key:InChIKey=ORRTWWAKVGSKEO-UHFFFAOYSA-N
SMILES:ClC1=NC(=NS1)N2CCN(CC3=CC=CC=C3)CC2
Synonyms:
  • Piperazine, 1-(5-chloro-1,2,4-thiadiazol-3-yl)-4-(phenylmethyl)-
  • 1-(5-Chloro-1,2,4-thiadiazol-3-yl)-4-(phenylmethyl)piperazine
  • 1-Benzyl-4-(5-chloro-1,2,4-thiadiazol-3-yl)piperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.