CymitQuimica logo

CAS 887623-95-2

:

1-Piperazinecarboxylic acid, 4-(hydrazonomethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1)

Description:
1-Piperazinecarboxylic acid, 4-(hydrazonomethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1), identified by CAS number 887623-95-2, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a hydrazonomethyl group, indicating the presence of a hydrazone functional group, which is formed by the reaction of hydrazine with carbonyl compounds. The presence of the 1,1-dimethylethyl ester suggests that it has a bulky substituent, which can influence its solubility and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its potential applications in biological systems. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its structural features suggest potential interactions with biological targets, but specific pharmacological properties would require further investigation through experimental studies. Overall, this compound represents a unique combination of functional groups that may contribute to its chemical behavior and potential applications.
Formula:C10H20N4O2·ClH
InChI:InChI=1S/C10H20N4O2.ClH/c1-10(2,3)16-9(15)14-6-4-13(5-7-14)8-12-11;/h8H,4-7,11H2,1-3H3;1H
InChI key:InChIKey=UHGYYNALQMFBMU-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCN(C=NN)CC1.Cl
Synonyms:
  • 1-Piperazinecarboxylic acid, 4-(hydrazonomethyl)-, 1,1-dimethylethyl ester, monohydrochloride
  • 1-Piperazinecarboxylic acid, 4-(hydrazonomethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.