CAS 887625-25-4
:1-[4-(4-Fluorophenyl)-2-thiazolyl]piperazine
Description:
1-[4-(4-Fluorophenyl)-2-thiazolyl]piperazine is a chemical compound characterized by its unique structural features, which include a piperazine ring and a thiazole moiety substituted with a fluorophenyl group. The presence of the fluorine atom enhances its lipophilicity and may influence its biological activity. This compound is typically classified as a heterocyclic organic compound, and its thiazole and piperazine components contribute to its potential pharmacological properties. It may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. The compound's molecular structure allows for interactions with biological targets, which can be explored for therapeutic applications. Additionally, its CAS number, 887625-25-4, serves as a unique identifier for regulatory and research purposes. As with many compounds in this category, understanding its solubility, stability, and reactivity is crucial for applications in pharmaceuticals and related fields.
Formula:C13H14FN3S
InChI:InChI=1S/C13H14FN3S/c14-11-3-1-10(2-4-11)12-9-18-13(16-12)17-7-5-15-6-8-17/h1-4,9,15H,5-8H2
InChI key:InChIKey=DZOSNUNUESTDRS-UHFFFAOYSA-N
SMILES:FC1=CC=C(C=2N=C(SC2)N3CCNCC3)C=C1
Synonyms:- 1-[4-(4-Fluorophenyl)-2-thiazolyl]piperazine
- 1-[4-(4-Fluorophenyl)thiazol-2-yl]piperazine
- Piperazine, 1-[4-(4-fluorophenyl)-2-thiazolyl]-
- 1-[4-(4-Fluorophenyl)-1,3-thiazol-2-yl]piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.