CymitQuimica logo

CAS 88767-13-9

:

(1S,2R,3S,5S)-3-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol

Description:
The chemical substance with the name "(1S,2R,3S,5S)-3-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol" and CAS number "88767-13-9" is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a cyclopentane ring with hydroxymethyl and diol functionalities, which contribute to its potential solubility and reactivity. The presence of the pyrrolo[2,3-d]pyrimidine moiety indicates that it may exhibit biological activity, possibly as a pharmaceutical agent or a biochemical probe. The amino group enhances its potential for hydrogen bonding and interactions with biological targets. This compound's stereochemical configuration suggests that it may have specific interactions in biological systems, influencing its pharmacodynamics and pharmacokinetics. Overall, its structural complexity and functional groups suggest potential applications in medicinal chemistry, particularly in the development of therapeutics targeting nucleic acid structures or enzymes involved in cellular processes.
Formula:C12H16N4O3
InChI:InChI=1/C12H16N4O3/c13-11-7-1-2-16(12(7)15-5-14-11)8-3-6(4-17)9(18)10(8)19/h1-2,5-6,8-10,17-19H,3-4H2,(H2,13,14,15)/t6-,8-,9-,10+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.