CAS 88768-45-0
:2-(2-Pyrimidinylthio)acetic acid
Description:
2-(2-Pyrimidinylthio)acetic acid, with the CAS number 88768-45-0, is an organic compound characterized by the presence of a pyrimidine ring and a thiol group attached to an acetic acid moiety. This compound typically exhibits properties associated with both acidic and heterocyclic compounds. The pyrimidine ring contributes to its potential biological activity, as pyrimidines are often found in various pharmaceuticals and agrochemicals. The thiol group can impart nucleophilic characteristics, making the compound reactive in certain chemical environments. In terms of solubility, it is likely to be soluble in polar solvents due to the presence of the carboxylic acid functional group. The compound may also exhibit moderate stability under standard conditions, although specific stability can depend on environmental factors such as pH and temperature. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Overall, 2-(2-Pyrimidinylthio)acetic acid is a compound of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C6H6N2O2S
InChI:InChI=1S/C6H6N2O2S/c9-5(10)4-11-6-7-2-1-3-8-6/h1-3H,4H2,(H,9,10)
InChI key:InChIKey=NIEOYUNNKKAQKI-UHFFFAOYSA-N
SMILES:S(CC(O)=O)C=1N=CC=CN1
Synonyms:- (2-Pyrimidylthio)acetic acid
- (Pyrimidin-2-Ylsulfanyl)Acetate
- (Pyrimidin-2-Ylsulfanyl)Acetic Acid
- 2-(2-Pyrimidinylthio)acetic acid
- 2-(Carboxymethylthio)pyrimidine
- 2-(Pyrimidin-2-ylsulfanyl)acetic acid
- 2-Pyrimidin-2-ylsulfanylacetic acid
- 4-Pyrimidylthioacetic acid
- Acetic acid, (2-pyrimidinylthio)-
- Acetic acid, 2-(2-pyrimidinylthio)-
- [(Pyrimidin-2-yl)thio]acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Pyrimidin-2-ylthio)acetic acid
CAS:Formula:C6H6N2O2SPurity:98%Color and Shape:SolidMolecular weight:170.18902-(Pyrimidin-2-Ylthio)Acetic Acid
CAS:2-(Pyrimidin-2-Ylthio)Acetic AcidPurity:98%Molecular weight:170.19g/mol(2-Pyrimidylthio)acetic acid
CAS:2-Pyrimidylthio)acetic acid is an amide that has been shown to form a crystalline solid with diffraction properties. The molecular structure of this compound was determined by X-ray crystallography and showed that it has a reactive nature. 2-Pyrimidylthio)acetic acid is able to form an adsorption isotherm for the desorption of anions by magnetic nanoparticles, which may be due to its supramolecular interactions. It has also been shown to have kinetic and adsorption properties.
Formula:C6H6N2O2SPurity:Min. 95%Color and Shape:PowderMolecular weight:170.19 g/mol



