CymitQuimica logo

CAS 88768-46-1

:

{[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}acetic acid

Description:
The chemical substance known as {[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}acetic acid, with the CAS number 88768-46-1, is a pyrimidine derivative characterized by the presence of a sulfanyl (thio) group and an acetic acid moiety. This compound features a pyrimidine ring substituted with a methyl group and a trifluoromethyl group, which contribute to its unique chemical properties. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, while the sulfanyl group may participate in various chemical reactions, including nucleophilic substitutions. The acetic acid portion of the molecule introduces acidity, allowing for potential interactions in biological systems. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in a given environment.
Formula:C8H7F3N2O2S
InChI:InChI=1/C8H7F3N2O2S/c1-4-2-5(8(9,10)11)13-7(12-4)16-3-6(14)15/h2H,3H2,1H3,(H,14,15)
SMILES:Cc1cc(C(F)(F)F)nc(n1)SCC(=O)O
Synonyms:
  • {[4-Methyl-6-(Trifluoromethyl)Pyrimidin-2-Yl]Thio}Acetic Acid
  • Acetic acid, 2-[[4-methyl-6-(trifluoromethyl)-2-pyrimidinyl]thio]-
  • {[4-Methyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.