
CAS 88768-47-2
:2-[(4-Methoxy-6-methyl-2-pyrimidinyl)thio]acetic acid
Description:
2-[(4-Methoxy-6-methyl-2-pyrimidinyl)thio]acetic acid, with the CAS number 88768-47-2, is a chemical compound characterized by its unique structure that includes a pyrimidine ring substituted with a methoxy and a methyl group, along with a thioacetic acid moiety. This compound typically exhibits properties associated with both thioesters and carboxylic acids, which may influence its reactivity and solubility. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals due to its heterocyclic nature. The presence of the methoxy group can enhance lipophilicity, while the thioacetic acid component may contribute to its biological activity. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use.
Formula:C8H10N2O3S
InChI:InChI=1S/C8H10N2O3S/c1-5-3-6(13-2)10-8(9-5)14-4-7(11)12/h3H,4H2,1-2H3,(H,11,12)
InChI key:InChIKey=VJWTZMALUAVWFP-UHFFFAOYSA-N
SMILES:S(CC(O)=O)C=1N=C(OC)C=C(C)N1
Synonyms:- Acetic acid, 2-[(4-methoxy-6-methyl-2-pyrimidinyl)thio]-
- 2-[(4-Methoxy-6-methyl-2-pyrimidinyl)thio]acetic acid
- 2-[(4-Methoxy-6-methylpyrimidin-2-yl)sulfanyl]acetic acid
- Acetic acid, [(4-methoxy-6-methyl-2-pyrimidinyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
