CymitQuimica logo

CAS 88770-19-8

:

3-Thiophenecarboxylic acid, 5-bromo-, methyl ester

Description:
3-Thiophenecarboxylic acid, 5-bromo-, methyl ester is an organic compound characterized by the presence of a thiophene ring, a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group that is esterified with methanol, resulting in a methyl ester. The bromine substituent at the 5-position of the thiophene ring introduces a halogen, which can influence the compound's reactivity and physical properties. Typically, such compounds exhibit moderate solubility in organic solvents and may have varying degrees of polarity due to the presence of both the thiophene and carboxylic acid moieties. The compound may be utilized in various chemical syntheses, including the development of pharmaceuticals or agrochemicals, owing to the biological activity often associated with thiophene derivatives. Additionally, the presence of the bromine atom can enhance electrophilic substitution reactions, making it a valuable intermediate in organic synthesis. Overall, 3-Thiophenecarboxylic acid, 5-bromo-, methyl ester is a versatile compound with potential applications in various fields of chemistry.
Formula:C6H5BrO2S
InChI:InChI=1S/C6H5BrO2S/c1-9-6(8)4-2-5(7)10-3-4/h2-3H,1H3
InChI key:VFWZOBQPAHYSDL-UHFFFAOYSA-N
SMILES:COC(=O)C1=CSC(=C1)Br
Synonyms:
  • Methyl 5-Bromothiophene-3-Carboxylate
Found 5 products.