CAS 887707-25-7
:2-chloro-5-iodo-3-(trifluoromethyl)pyridine
Description:
2-Chloro-5-iodo-3-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a chlorine atom, an iodine atom, and a trifluoromethyl group. The presence of these substituents significantly influences its chemical properties, including its reactivity and polarity. The chlorine and iodine atoms introduce halogen functionalities, which can enhance the compound's electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The trifluoromethyl group is known for its electron-withdrawing properties, which can stabilize negative charges in reaction intermediates. This compound is typically used in pharmaceutical research and development due to its potential biological activity and ability to serve as a building block for more complex molecules. Additionally, its unique combination of halogen substituents may impart specific physical properties, such as solubility in organic solvents and altered boiling and melting points compared to unsubstituted pyridine derivatives. Overall, 2-chloro-5-iodo-3-(trifluoromethyl)pyridine is a valuable compound in synthetic organic chemistry.
Formula:C6H2ClF3IN
InChI:InChI=1S/C6H2ClF3IN/c7-5-4(6(8,9)10)1-3(11)2-12-5/h1-2H
SMILES:c1c(cnc(c1C(F)(F)F)Cl)I
Synonyms:- 2-Chloro-5-iodo-3-trifluoromethylpyridine
- 2-Chloro-5-Iodo-3-(Trifluoromethyl)-Pyridinone
- 2-Chloro-3-Trifluoromethyl-5-Iodopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-5-iodo-3-(trifluoromethyl)pyridine, 95%
CAS:<p>It is used as pharmaceutical intermediate and as an advanced chemical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item c</p>Formula:C6H2ClF3INPurity:95%Molecular weight:307.442-CHLORO-5-IODO-3-(TRIFLUOROMETHYL)-PYRIDINONE
CAS:Formula:C6H2ClF3INPurity:97%Color and Shape:SolidMolecular weight:307.43952-Chloro-5-iodo-3-(trifluoromethyl)pyridine
CAS:<p>2-Chloro-5-iodo-3-(trifluoromethyl)pyridine</p>Purity:97%Molecular weight:307.44g/mol2-Chloro-5-iodo-3-(trifluoromethyl)pyridine
CAS:Formula:C6H2ClF3INPurity:98.0%Color and Shape:SolidMolecular weight:307.442-chloro-5-iodo-3-(trifluoromethyl)pyridine
CAS:<p>Please enquire for more information about 2-chloro-5-iodo-3-(trifluoromethyl)pyridine including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C6H2ClF3INOPurity:Min. 95%Molecular weight:323.44 g/mol




