
CAS 887707-31-5
:6-Methoxy-5-(trifluoromethyl)-3-pyridinemethanol
Description:
6-Methoxy-5-(trifluoromethyl)-3-pyridinemethanol is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 6-position and a trifluoromethyl group (-CF3) at the 5-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The hydroxymethyl group (-CH2OH) at the 3-position enhances its reactivity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its trifluoromethyl group can influence the compound's electronic properties, potentially affecting its interaction with biological targets. Additionally, the presence of fluorine atoms often enhances metabolic stability and bioavailability. Overall, 6-Methoxy-5-(trifluoromethyl)-3-pyridinemethanol is a versatile compound with potential applications in drug development and other fields of chemical research.
Formula:C8H8F3NO2
InChI:InChI=1S/C8H8F3NO2/c1-14-7-6(8(9,10)11)2-5(4-13)3-12-7/h2-3,13H,4H2,1H3
InChI key:InChIKey=XVQMJTDLNRIYHV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(OC)N=CC(CO)=C1
Synonyms:- [6-Methoxy-5-(trifluoromethyl)pyridin-3-yl]methanol
- 2-Methoxy-3-trifluoromethyl-5-pyridinemethanol
- 3-Pyridinemethanol, 6-methoxy-5-(trifluoromethyl)-
- 6-Methoxy-5-(trifluoromethyl)-3-pyridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.