
CAS 887707-33-7
:2-Chloro-5-(chloromethyl)-3-(trifluoromethyl)pyridine
Description:
2-Chloro-5-(chloromethyl)-3-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chlorine atom at the 2-position and a chloromethyl group at the 5-position introduces significant reactivity, while the trifluoromethyl group at the 3-position enhances its lipophilicity and potential for biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is known for its stability under standard conditions. It is soluble in organic solvents and may exhibit moderate to high toxicity, necessitating careful handling. The trifluoromethyl group contributes to its unique electronic properties, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its reactivity profile allows for potential applications in synthesis and as an intermediate in the production of more complex molecules. As with many halogenated compounds, it is important to consider environmental and health impacts during its use and disposal.
Formula:C7H4Cl2F3N
InChI:InChI=1S/C7H4Cl2F3N/c8-2-4-1-5(7(10,11)12)6(9)13-3-4/h1,3H,2H2
InChI key:InChIKey=PCJYQUIGRBJXOM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(CCl)C=NC1Cl
Synonyms:- 2-Chloro-5-(chloromethyl)-3-(trifluoromethyl)pyridine
- Pyridine, 2-chloro-5-(chloromethyl)-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.