CymitQuimica logo

CAS 88775-46-6

:

2-Propen-1-one, 1-(1,3-benzodioxol-5-yl)-3-(3,5-dimethoxyphenyl)-, (E)-

Description:
2-Propen-1-one, 1-(1,3-benzodioxol-5-yl)-3-(3,5-dimethoxyphenyl)-, (E)-, also known by its CAS number 88775-46-6, is an organic compound characterized by its conjugated double bond system, which contributes to its reactivity and potential applications in organic synthesis. This compound features a benzodioxole moiety, which is known for its aromatic properties and potential biological activity, along with a dimethoxyphenyl group that enhances its electron-donating characteristics. The (E)- configuration indicates that the substituents around the double bond are on opposite sides, which can influence its physical properties and reactivity. Typically, compounds of this nature may exhibit interesting optical properties and can be utilized in various fields, including pharmaceuticals and materials science. Its structural complexity suggests potential for interactions with biological systems, making it a candidate for further research in medicinal chemistry. Overall, this compound exemplifies the diverse functionalities that can arise from the combination of different aromatic and aliphatic systems in organic chemistry.
Formula:C18H16O5
InChI:InChI=1S/C18H16O5/c1-20-14-7-12(8-15(10-14)21-2)3-5-16(19)13-4-6-17-18(9-13)23-11-22-17/h3-10H,11H2,1-2H3/b5-3+
InChI key:InChIKey=GRDDEUBHXDURLH-HWKANZROSA-N
SMILES:C(/C=C/C1=CC(OC)=CC(OC)=C1)(=O)C=2C=C3C(=CC2)OCO3
Synonyms:
  • 2-Propen-1-one, 1-(1,3-benzodioxol-5-yl)-3-(3,5-dimethoxyphenyl)-, (E)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.