CymitQuimica logo

CAS 887781-90-0

:

4-Bromo-α-(difluoromethyl)-α-methylbenzenemethanol

Description:
4-Bromo-α-(difluoromethyl)-α-methylbenzenemethanol is a chemical compound characterized by its complex structure, which includes a bromine atom, a difluoromethyl group, and a hydroxymethyl group attached to a methyl-substituted aromatic ring. This compound is likely to exhibit properties typical of halogenated organic compounds, such as increased lipophilicity and potential biological activity. The presence of the difluoromethyl group may enhance its reactivity and influence its interactions with biological targets. Additionally, the hydroxymethyl group can participate in hydrogen bonding, affecting its solubility and reactivity in various solvents. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise characterization. Safety data should also be consulted, as halogenated compounds can pose environmental and health risks.
Formula:C9H9BrF2O
InChI:InChI=1S/C9H9BrF2O/c1-9(13,8(11)12)6-2-4-7(10)5-3-6/h2-5,8,13H,1H3
InChI key:InChIKey=SXHGHWIMGNZPFT-UHFFFAOYSA-N
SMILES:C(C(F)F)(C)(O)C1=CC=C(Br)C=C1
Synonyms:
  • 4-Bromo-α-(difluoromethyl)-α-methylbenzenemethanol
  • 2-(4-Bromo-phenyl)-1,1-difluoro-propan-2-ol
  • 2-(4-Bromophenyl)-1,1-difluoropropan-2-ol
  • Benzenemethanol, 4-bromo-α-(difluoromethyl)-α-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.