CAS 887833-27-4

1-(9H-Purin-6-yl)-4-piperidinecarboxylic acid

Description:

1-(9H-Purin-6-yl)-4-piperidinecarboxylic acid, with the CAS number 887833-27-4, is a chemical compound characterized by its unique structure that combines a purine moiety with a piperidine ring. This compound features a piperidine ring substituted with a carboxylic acid group, which contributes to its potential biological activity. The purine structure is known for its role in various biological processes, including nucleic acid metabolism. The presence of the carboxylic acid functional group suggests that this compound may exhibit acidic properties, influencing its solubility and reactivity in different environments. Additionally, the compound may interact with biological targets, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and spectral properties, would typically be determined through experimental methods. Overall, 1-(9H-Purin-6-yl)-4-piperidinecarboxylic acid represents a class of compounds that may have significant implications in pharmacology and biochemistry.

Formula: C₁₁H₁₃N₅O₂

InChI: InChI=1S/C11H13N5O2/c17-11(18)7-1-3-16(4-2-7)10-8-9(13-5-12-8)14-6-15-10/h5-7H,1-4H2,(H,17,18)(H,12,13,14,15)

InChI key: InChIKey=WSSRJDISLPBFJN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CCN(C2=C3C(N=CN3)=NC=N2)CC1

Synonyms:

• 4-Piperidinecarboxylic acid, 1-(1H-purin-6-yl)-
• 1-(7H-Purin-6-yl)piperidine-4-carboxylic acid
• 4-Piperidinecarboxylic acid, 1-(9H-purin-6-yl)-
• 1-(9H-Purin-6-yl)-4-piperidinecarboxylic acid