CAS 887833-28-5

4-Methyl-7-[(2-methyl-2-propen-1-yl)oxy]-2-oxo-2H-1-benzopyran-3-acetic acid

Description:

4-Methyl-7-[(2-methyl-2-propen-1-yl)oxy]-2-oxo-2H-1-benzopyran-3-acetic acid, with the CAS number 887833-28-5, is a synthetic organic compound belonging to the class of flavonoids. This compound features a benzopyran core structure, which is characteristic of many flavonoids, and is substituted with a methyl group and an allyloxy group, contributing to its unique chemical properties. It exhibits potential biological activities, including antioxidant and anti-inflammatory effects, which are common in flavonoid derivatives. The presence of the acetic acid moiety suggests that it may also have acidic properties, influencing its solubility and reactivity in various environments. Its molecular structure allows for interactions with biological targets, making it of interest in pharmaceutical research. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its application and study. Overall, this compound represents a fascinating area of research within the field of medicinal chemistry and natural product synthesis.

Formula: C₁₆H₁₆O₅

InChI: InChI=1S/C16H16O5/c1-9(2)8-20-11-4-5-12-10(3)13(7-15(17)18)16(19)21-14(12)6-11/h4-6H,1,7-8H2,2-3H3,(H,17,18)

InChI key: InChIKey=SGOMJVLXOVSUJC-UHFFFAOYSA-N

SMILES: CC=1C=2C(=CC(OCC(C)=C)=CC2)OC(=O)C1CC(O)=O

Synonyms:

• 4-Methyl-7-[(2-methyl-2-propen-1-yl)oxy]-2-oxo-2H-1-benzopyran-3-acetic acid
• 2H-1-Benzopyran-3-acetic acid, 4-methyl-7-[(2-methyl-2-propenyl)oxy]-2-oxo-
• 2H-1-Benzopyran-3-acetic acid, 4-methyl-7-[(2-methyl-2-propen-1-yl)oxy]-2-oxo-