CAS 887833-29-6
:4,8-Dimethyl-7-[(2-methyl-2-propen-1-yl)oxy]-2-oxo-2H-1-benzopyran-3-acetic acid
Description:
4,8-Dimethyl-7-[(2-methyl-2-propen-1-yl)oxy]-2-oxo-2H-1-benzopyran-3-acetic acid, with the CAS number 887833-29-6, is a synthetic organic compound that belongs to the class of flavonoids, specifically a benzopyran derivative. This compound features a complex structure characterized by a benzopyran core, which is a fused ring system containing both aromatic and heterocyclic components. The presence of multiple methyl groups and an allylic ether substituent contributes to its unique chemical properties and potential biological activities. It is likely to exhibit various functional properties due to the presence of the carboxylic acid group, which can participate in hydrogen bonding and influence solubility. The compound may also possess antioxidant or anti-inflammatory activities, common among flavonoids, although specific biological activities would require empirical investigation. Its structural complexity suggests potential applications in pharmaceuticals or as a lead compound in drug development, particularly in areas related to health and wellness.
Formula:C17H18O5
InChI:InChI=1S/C17H18O5/c1-9(2)8-21-14-6-5-12-10(3)13(7-15(18)19)17(20)22-16(12)11(14)4/h5-6H,1,7-8H2,2-4H3,(H,18,19)
InChI key:InChIKey=OJSKMJCWTUNWME-UHFFFAOYSA-N
SMILES:CC=1C=2C(=C(C)C(OCC(C)=C)=CC2)OC(=O)C1CC(O)=O
Synonyms:- 2H-1-Benzopyran-3-acetic acid, 4,8-dimethyl-7-[(2-methyl-2-propenyl)oxy]-2-oxo-
- 4,8-Dimethyl-7-[(2-methyl-2-propen-1-yl)oxy]-2-oxo-2H-1-benzopyran-3-acetic acid
- 2H-1-Benzopyran-3-acetic acid, 4,8-dimethyl-7-[(2-methyl-2-propen-1-yl)oxy]-2-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.