CymitQuimica logo

CAS 88791-09-7

:

7-Hydroxybenzo[b]thiophene-2-carboxylic acid

Description:
7-Hydroxybenzo[b]thiophene-2-carboxylic acid, with the CAS number 88791-09-7, is an organic compound that features a fused ring system comprising a benzene ring and a thiophene ring, along with a carboxylic acid and a hydroxyl functional group. This compound is characterized by its potential biological activity, which may include antimicrobial or anti-inflammatory properties, making it of interest in medicinal chemistry. The presence of the hydroxyl group contributes to its solubility in polar solvents, while the carboxylic acid group can participate in hydrogen bonding and influence its reactivity and interaction with biological targets. Additionally, the unique structure of the fused rings may impart specific electronic properties, affecting its behavior in chemical reactions and interactions with other molecules. Overall, 7-Hydroxybenzo[b]thiophene-2-carboxylic acid is a compound of interest for further research in various fields, including pharmaceuticals and materials science.
Formula:C9H6O3S
InChI:InChI=1S/C9H6O3S/c10-6-3-1-2-5-4-7(9(11)12)13-8(5)6/h1-4,10H,(H,11,12)
InChI key:InChIKey=HNMNLWZGTWHBCM-UHFFFAOYSA-N
SMILES:OC1=C2C(C=C(C(O)=O)S2)=CC=C1
Synonyms:
  • 7-Hydroxybenzo[b]thiophene-2-carboxylic acid
  • Benzo[b]thiophene-2-carboxylic acid, 7-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.