CymitQuimica logo

CAS 887922-91-0

:

N-methyl-1-[1-(6-methylpyrazin-2-yl)-4-piperidyl]methanamine

Description:
N-methyl-1-[1-(6-methylpyrazin-2-yl)-4-piperidyl]methanamine, with the CAS number 887922-91-0, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyrazine moiety. This substance is typically classified as an organic amine, featuring a methyl group attached to the nitrogen atom of the piperidine ring. The presence of the 6-methylpyrazin-2-yl group suggests potential biological activity, as pyrazine derivatives are often explored for their pharmacological properties. The compound may exhibit properties such as solubility in organic solvents and moderate polarity, which can influence its behavior in biological systems. Its structural features may allow for interactions with various biological targets, making it of interest in medicinal chemistry. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies. Overall, this compound represents a unique structure that could be relevant in the development of therapeutic agents.
Formula:C12H20N4
InChI:InChI=1/C12H20N4/c1-10-7-14-9-12(15-10)16-5-3-11(4-6-16)8-13-2/h7,9,11,13H,3-6,8H2,1-2H3
SMILES:Cc1cncc(n1)N1CCC(CC1)CNC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.