CAS 88793-45-7

Ethanol, 2,2′-[(6-amino-3-chloro-5-nitropyrazinyl)imino]bis-

Description:

Ethanol, 2,2′-[(6-amino-3-chloro-5-nitropyrazinyl)imino]bis- is a chemical compound characterized by its complex structure, which includes an ethanol moiety and a bis-imino linkage to a nitropyrazine derivative. The presence of the amino and chloro groups suggests potential for hydrogen bonding and reactivity, while the nitro group may impart additional properties such as increased electron-withdrawing capability. This compound is likely to exhibit moderate solubility in polar solvents due to the ethanol component, while the pyrazine ring may contribute to its aromatic characteristics. The presence of multiple functional groups indicates potential biological activity, making it of interest in medicinal chemistry or as a potential pharmaceutical agent. Additionally, the compound's stability and reactivity would depend on environmental conditions such as pH and temperature. Overall, this compound represents a unique intersection of organic chemistry and potential applications in various fields, including drug development and materials science.

Formula: C₈H₁₂ClN₅O₄

InChI: InChI=1S/C8H12ClN5O4/c9-5-7(13(1-3-15)2-4-16)12-6(10)8(11-5)14(17)18/h15-16H,1-4H2,(H2,10,12)

InChI key: InChIKey=QYLSTKQFYNUKCI-UHFFFAOYSA-N

SMILES: N(CCO)(CCO)C=1C(Cl)=NC(N(=O)=O)=C(N)N1

Synonyms:

• Ethanol, 2,2′-[(6-amino-3-chloro-5-nitropyrazinyl)imino]bis-

2,2'-((6-Amino-3-chloro-5-nitropyrazin-2-yl)azanediyl)diethanol

CAS: 88793-45-7

Formula: C₈H₁₂ClN₅O₄

Molecular weight: 277.665

Ref: IN-DA004AU0