CymitQuimica logo

CAS 88796-62-7

:

2-[[(5-Nitro-2-furanyl)methyl]amino]benzoic acid

Description:
2-[[(5-Nitro-2-furanyl)methyl]amino]benzoic acid, with the CAS number 88796-62-7, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a nitrofuran group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate polarity due to the presence of the carboxylic acid functional group. The nitro group contributes to its electron-withdrawing characteristics, which can influence its reactivity and interaction with biological systems. Additionally, the presence of the furan ring may impart unique electronic properties and potential for participation in various chemical reactions, such as electrophilic substitutions. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and applications could be explored in the context of medicinal chemistry, particularly in the development of new therapeutic agents. Overall, 2-[[(5-Nitro-2-furanyl)methyl]amino]benzoic acid represents a fascinating subject for further study in both organic and medicinal chemistry.
Formula:C12H10N2O5
InChI:InChI=1S/C12H10N2O5/c15-12(16)9-3-1-2-4-10(9)13-7-8-5-6-11(19-8)14(17)18/h1-6,13H,7H2,(H,15,16)
InChI key:InChIKey=HFPOXHKFJDMGEH-UHFFFAOYSA-N
SMILES:N(CC=1OC(N(=O)=O)=CC1)C2=C(C(O)=O)C=CC=C2
Synonyms:
  • Benzoic acid, 2-[[(5-nitro-2-furanyl)methyl]amino]-
  • 2-[[(5-Nitro-2-furanyl)methyl]amino]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.