CAS 887973-47-9
:5-(2,3-Difluorophenyl)-3-pyridinecarboxylic acid
Description:
5-(2,3-Difluorophenyl)-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine and difluorophenyl moieties. It features a pyridine ring substituted with a carboxylic acid group at the 3-position and a 2,3-difluorophenyl group at the 5-position. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The difluorophenyl substituent introduces unique electronic properties, potentially influencing the compound's reactivity and interactions in biological systems. The presence of fluorine atoms can enhance lipophilicity and alter the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific biological activities, which could be explored in drug development contexts. Its CAS number, 887973-47-9, allows for easy identification and retrieval of information in chemical databases. Overall, this compound represents a valuable structure for further research in various chemical and pharmaceutical applications.
Formula:C12H7F2NO2
InChI:InChI=1S/C12H7F2NO2/c13-10-3-1-2-9(11(10)14)7-4-8(12(16)17)6-15-5-7/h1-6H,(H,16,17)
InChI key:InChIKey=XYLKJNIKNDDOLG-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C(O)=O)C=NC2)C=CC=C1F
Synonyms:- 3-Pyridinecarboxylic acid, 5-(2,3-difluorophenyl)-
- 5-(2,3-Difluorophenyl)-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
