CAS 887973-54-8
:5-[2-(Trifluoromethyl)phenyl]-3-pyridinecarboxylic acid
Description:
5-[2-(Trifluoromethyl)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 887973-54-8, is a chemical compound characterized by its unique structure that includes a pyridine ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid functional group. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the carboxylic acid moiety suggests that it can participate in hydrogen bonding and may exhibit acidic behavior in solution. Its molecular structure allows for various applications, particularly in medicinal chemistry, where it may serve as a scaffold for drug development. Overall, this compound's distinctive features contribute to its potential utility in various chemical and biological contexts.
Formula:C13H8F3NO2
InChI:InChI=1S/C13H8F3NO2/c14-13(15,16)11-4-2-1-3-10(11)8-5-9(12(18)19)7-17-6-8/h1-7H,(H,18,19)
InChI key:InChIKey=PCDJSPQHMSCSRI-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=CC=C1)C=2C=C(C(O)=O)C=NC2
Synonyms:- 3-Pyridinecarboxylic acid, 5-[2-(trifluoromethyl)phenyl]-
- 5-[2-(Trifluoromethyl)phenyl]-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
