CymitQuimica logo

CAS 887973-56-0

:

3-(5-Formyl-3-pyridinyl)benzonitrile

Description:
3-(5-Formyl-3-pyridinyl)benzonitrile, with the CAS number 887973-56-0, is an organic compound characterized by its complex structure that includes both a pyridine and a benzonitrile moiety. This compound features a formyl group (-CHO) attached to the pyridine ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of the benzonitrile group indicates that it has a nitrile functional group (-C≡N), which is known for its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. The compound is likely to exhibit polar characteristics due to the presence of the formyl and nitrile groups, influencing its solubility in polar solvents. Additionally, the aromatic nature of both the pyridine and benzene rings may impart stability and contribute to its electronic properties. Overall, this compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in the synthesis of more complex molecules.
Formula:C13H8N2O
InChI:InChI=1S/C13H8N2O/c14-6-10-2-1-3-12(4-10)13-5-11(9-16)7-15-8-13/h1-5,7-9H
InChI key:InChIKey=BOHZZEDUACILBG-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1)C=2C=C(C=O)C=NC2
Synonyms:
  • Benzonitrile, 3-(5-formyl-3-pyridinyl)-
  • 3-(5-Formyl-3-pyridinyl)benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.