CAS 887973-58-2

5-(2-Methoxyphenyl)-3-pyridinecarboxaldehyde

Description:

5-(2-Methoxyphenyl)-3-pyridinecarboxaldehyde, identified by its CAS number 887973-58-2, is an organic compound characterized by the presence of both a pyridine and an aldehyde functional group. This compound features a methoxy-substituted phenyl group attached to the pyridine ring, which contributes to its unique chemical properties. The methoxy group enhances the compound's solubility in organic solvents and can influence its reactivity and interaction with biological systems. The aldehyde functional group is known for its reactivity, particularly in condensation reactions and as a precursor in various synthetic pathways. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature.

Formula: C₁₃H₁₁NO₂

InChI: InChI=1S/C13H11NO2/c1-16-13-5-3-2-4-12(13)11-6-10(9-15)7-14-8-11/h2-9H,1H3

InChI key: InChIKey=GXYJPKHDPBBOCT-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=2C=C(C=O)C=NC2)C=CC=C1

Synonyms:

• 5-(2-Methoxyphenyl)-3-pyridinecarboxaldehyde
• 3-Pyridinecarboxaldehyde, 5-(2-methoxyphenyl)-