CAS 887973-61-7
:5-(2-Furanyl)-3-pyridinecarboxaldehyde
Description:
5-(2-Furanyl)-3-pyridinecarboxaldehyde, with the CAS number 887973-61-7, is an organic compound characterized by the presence of both a furan and a pyridine ring in its structure. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis. The furan ring, a five-membered aromatic heterocycle containing oxygen, imparts unique electronic properties, while the pyridine ring, a six-membered aromatic heterocycle containing nitrogen, adds basicity and potential for coordination with metal ions. The compound is typically a pale yellow to brown liquid or solid, depending on its purity and conditions. It is soluble in organic solvents, making it useful in various chemical reactions, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its reactivity can be attributed to the aldehyde group, which can participate in condensation reactions and nucleophilic additions. Overall, 5-(2-Furanyl)-3-pyridinecarboxaldehyde is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C10H7NO2
InChI:InChI=1S/C10H7NO2/c12-7-8-4-9(6-11-5-8)10-2-1-3-13-10/h1-7H
InChI key:InChIKey=NHNONBSKOMTGFM-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C2=CC=CO2
Synonyms:- 5-(2-Furanyl)-3-pyridinecarboxaldehyde
- 3-Pyridinecarboxaldehyde, 5-(2-furanyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
