CymitQuimica logo

CAS 887973-64-0

:

5-(3-Methoxyphenyl)-3-pyridinecarboxaldehyde

Description:
5-(3-Methoxyphenyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its unique structure, which includes a pyridine ring and an aldehyde functional group. The presence of the methoxyphenyl group contributes to its aromatic properties, enhancing its potential for various chemical reactions. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic aromatic components. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets through hydrogen bonding and π-π stacking interactions. Additionally, the aldehyde group can participate in further chemical transformations, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H11NO2
InChI:InChI=1S/C13H11NO2/c1-16-13-4-2-3-11(6-13)12-5-10(9-15)7-14-8-12/h2-9H,1H3
InChI key:InChIKey=SHHGRBQBFYDHFN-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1)C=2C=C(C=O)C=NC2
Synonyms:
  • 3-Pyridinecarboxaldehyde, 5-(3-methoxyphenyl)-
  • 5-(3-Methoxyphenyl)-3-pyridinecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.