
CAS 887973-65-1
:5-(4-Chlorophenyl)-3-pyridinecarboxaldehyde
Description:
5-(4-Chlorophenyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its unique structure, which includes a pyridine ring and an aldehyde functional group. The presence of the 4-chlorophenyl group enhances its reactivity and potential applications in various chemical reactions. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its aromatic properties due to the chlorophenyl moiety. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, owing to its ability to serve as an intermediate in the synthesis of more complex molecules. The compound's reactivity can be attributed to the electrophilic nature of the aldehyde group, making it suitable for nucleophilic addition reactions. Additionally, its solubility characteristics can vary, influencing its application in different solvents. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken during use.
Formula:C12H8ClNO
InChI:InChI=1S/C12H8ClNO/c13-12-3-1-10(2-4-12)11-5-9(8-15)6-14-7-11/h1-8H
InChI key:InChIKey=ZMKSDBAOUPRHQA-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C2=CC=C(Cl)C=C2
Synonyms:- 5-(4-Chlorophenyl)-3-pyridinecarboxaldehyde
- 3-Pyridinecarboxaldehyde, 5-(4-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
