CAS 887973-66-2
:5-(3-Methylphenyl)-3-pyridinecarboxaldehyde
Description:
5-(3-Methylphenyl)-3-pyridinecarboxaldehyde, identified by its CAS number 887973-66-2, is an organic compound characterized by the presence of both a pyridine ring and an aldehyde functional group. This compound features a pyridine ring substituted at the 3-position with a carboxaldehyde group and at the 5-position with a 3-methylphenyl group, which contributes to its aromatic character. The presence of the methyl group on the phenyl ring enhances its hydrophobic properties, while the aldehyde group introduces reactivity typical of carbonyl compounds, making it useful in various chemical reactions, including condensation and oxidation. The compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. Its unique structure suggests potential applications in organic synthesis, pharmaceuticals, and as a building block in the development of more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C13H11NO
InChI:InChI=1S/C13H11NO/c1-10-3-2-4-12(5-10)13-6-11(9-15)7-14-8-13/h2-9H,1H3
InChI key:InChIKey=BTZNYANYLFRDHW-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C2=CC(C)=CC=C2
Synonyms:- 3-Pyridinecarboxaldehyde, 5-(3-methylphenyl)-
- 5-(3-Methylphenyl)-3-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
