CAS 887973-73-1

5-(4-Bromophenyl)-3-pyridinecarboxaldehyde

Description:

5-(4-Bromophenyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its unique structure, which includes a pyridine ring and a bromophenyl group. The presence of the aldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents like ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic aromatic components. The bromine atom in the para position of the phenyl ring can influence the compound's reactivity and polarity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. Safety precautions should be taken when handling this compound, as with many organic chemicals, due to potential toxicity and reactivity.

Formula: C₁₂H₈BrNO

InChI: InChI=1S/C12H8BrNO/c13-12-3-1-10(2-4-12)11-5-9(8-15)6-14-7-11/h1-8H

InChI key: InChIKey=ODDJTWWBSRURCF-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(=CN=C1)C2=CC=C(Br)C=C2

Synonyms:

• 3-Pyridinecarboxaldehyde, 5-(4-bromophenyl)-
• 5-(4-Bromophenyl)-3-pyridinecarboxaldehyde